24936-44-5 Poly(4-methoxystyrene)
| Nome do produto |
Poly(4-methoxystyrene) |
| Nome em inglês |
Poly(4-methoxystyrene); 4-Methoxystyrene Resin; 1-ethenyl-4-methoxybenzene |
| Fórmula molecular |
C9H10O |
| Peso Molecular |
134.1751 |
| InChI |
InChI=1/C9H10O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1H2,2H3 |
| CAS Registry Number |
24936-44-5 |
| EINECS |
211-298-9 |
| Estrutura Molecular |
|
| Densidade |
0.962g/cm3 |
| Ponto de ebuli??o |
220.7°C at 760 mmHg |
| índice de refra??o |
1.541 |
| O ponto de inflama??o |
77.7°C |
| Press?o de vapor |
0.165mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|