24936-44-5 Poly(4-methoxystyrene)
| Nome del prodotto |
Poly(4-methoxystyrene) |
| Nome inglese |
Poly(4-methoxystyrene); 4-Methoxystyrene Resin; 1-ethenyl-4-methoxybenzene |
| Formula molecolare |
C9H10O |
| Peso Molecolare |
134.1751 |
| InChI |
InChI=1/C9H10O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1H2,2H3 |
| Numero CAS |
24936-44-5 |
| EINECS |
211-298-9 |
| Struttura molecolare |
|
| Densità |
0.962g/cm3 |
| Punto di ebollizione |
220.7°C at 760 mmHg |
| Indice di rifrazione |
1.541 |
| Punto d'infiammabilità |
77.7°C |
| Pressione di vapore |
0.165mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|