24936-44-5 Poly(4-methoxystyrene)
| Nom |
Poly(4-methoxystyrene) |
| Nom anglais |
Poly(4-methoxystyrene); 4-Methoxystyrene Resin; 1-ethenyl-4-methoxybenzene |
| Formule moléculaire |
C9H10O |
| Poids Moléculaire |
134.1751 |
| InChI |
InChI=1/C9H10O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1H2,2H3 |
| Numéro de registre CAS |
24936-44-5 |
| EINECS |
211-298-9 |
| Structure moléculaire |
|
| Densité |
0.962g/cm3 |
| Point d'ébullition |
220.7°C at 760 mmHg |
| Indice de réfraction |
1.541 |
| Point d'éclair |
77.7°C |
| Pression de vapeur |
0.165mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|