2642-98-0 6-Aminochrysene
| Nazwa produktu: |
6-Aminochrysene |
| Angielska nazwa |
6-Aminochrysene; 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| MF |
C18H13N |
| Masie cz?steczkowej |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| Nr CAS |
2642-98-0 |
| EINECS |
220-149-7 |
| Struktury molekularnej |
|
| G?sto?? |
1.253g/cm3 |
| Temperatura topnienia |
206-211℃ |
| Temperatura wrzenia |
501.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.813 |
| Temperatura zap?onu |
286.9°C |
| Ci?nienie pary |
3.56E-10mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|