2642-98-0 6-Aminochrysene
| Produkt-Name |
6-Aminochrysene |
| Englischer Name |
6-Aminochrysene; 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| Molekulare Formel |
C18H13N |
| Molecular Weight |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| CAS Registry Number |
2642-98-0 |
| EINECS |
220-149-7 |
| Molecular Structure |
|
| Dichte |
1.253g/cm3 |
| Schmelzpunkt |
206-211℃ |
| Siedepunkt |
501.2°C at 760 mmHg |
| Brechungsindex |
1.813 |
| Flammpunkt |
286.9°C |
| Dampfdruck |
3.56E-10mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|