2642-98-0 6-Aminochrysene
| produktnavn |
6-Aminochrysene |
| Engelsk navn |
6-Aminochrysene; 6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| Molekyl?r Formel |
C18H13N |
| Molekylvekt |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| CAS-nummer |
2642-98-0 |
| EINECS |
220-149-7 |
| Molecular Structure |
|
| Tetthet |
1.253g/cm3 |
| Smeltepunkt |
206-211℃ |
| Kokepunkt |
501.2°C at 760 mmHg |
| Brytningsindeks |
1.813 |
| Flammepunktet |
286.9°C |
| Damptrykk |
3.56E-10mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|