ChemNet > CAS > 19847-10-0 2-Pyrazinecarbonyl chloride
19847-10-0 2-Pyrazinecarbonyl chloride
| Nazwa produktu: |
2-Pyrazinecarbonyl chloride |
| Angielska nazwa |
2-Pyrazinecarbonyl chloride; Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
| MF |
C5H3ClN2O |
| Masie cz?steczkowej |
142.5431 |
| InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
| Nr CAS |
19847-10-0 |
| EINECS |
243-367-4 |
| Struktury molekularnej |
|
| G?sto?? |
1.393g/cm3 |
| Temperatura topnienia |
40.9℃ |
| Temperatura wrzenia |
214.5°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.551 |
| Temperatura zap?onu |
83.5°C |
| Ci?nienie pary |
0.155mmHg at 25°C |
| Symbole zagro?enia |
C:Corrosive;
|
| Kody ryzyka |
R34:Causes burns.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|