ChemNet > CAS > 19847-10-0 2-Pyrazinecarbonyl chloride
19847-10-0 2-Pyrazinecarbonyl chloride
| termék neve |
2-Pyrazinecarbonyl chloride |
| Angol név |
2-Pyrazinecarbonyl chloride; Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
| MF |
C5H3ClN2O |
| Molekulat?meg |
142.5431 |
| InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
| CAS-szám |
19847-10-0 |
| EINECS |
243-367-4 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.393g/cm3 |
| Olvadáspont |
40.9℃ |
| Forráspont |
214.5°C at 760 mmHg |
| T?résmutató |
1.551 |
| Gyulladáspont |
83.5°C |
| G?znyomás |
0.155mmHg at 25°C |
| Veszély szimbólumok |
C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|