ChemNet > CAS > 19847-10-0 2-Pyrazinecarbonyl chloride
19847-10-0 2-Pyrazinecarbonyl chloride
| product Name |
2-Pyrazinecarbonyl chloride |
| CAS No |
19847-10-0 |
| Synonyms |
Pyrazinecarbonyl chloride; Pyrazine-2-carbonyl chloride |
| Molecular Formula |
C5H3ClN2O |
| Molecular Weight |
142.5431 |
| InChI |
InChI=1/C5H3ClN2O/c6-5(9)4-3-7-1-2-8-4/h1-3H |
| EINECS |
243-367-4 |
| Molecular Structure |
|
| Density |
1.393g/cm3 |
| Melting point |
40.9℃ |
| Boiling point |
214.5°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
83.5°C |
| Vapour Pressur |
0.155mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|