97-95-0 2-Ethyl-1-butanol
| produktnavn |
2-Ethyl-1-butanol |
| Engelsk navn |
2-Ethyl-1-butanol; 2-Ethylbutyl alcohol; 2-ethylbutan-1-ol |
| Molekyl?r Formel |
C6H14O |
| Molekylvekt |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
| CAS-nummer |
97-95-0 |
| EINECS |
202-621-4 |
| Molecular Structure |
|
| Tetthet |
0.814g/cm3 |
| Smeltepunkt |
-15℃ |
| Kokepunkt |
146.5°C at 760 mmHg |
| Brytningsindeks |
1.413 |
| Flammepunktet |
58.3°C |
| Damptrykk |
1.81mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R21/22:Harmful in contact with skin and if swallowed.;
|
|