97-95-0 2-Ethyl-1-butanol
| product Name |
2-Ethyl-1-butanol |
| CAS No |
97-95-0 |
| Synonyms |
2-Ethylbutyl alcohol; 2-ethylbutan-1-ol |
| Molecular Formula |
C6H14O |
| Molecular Weight |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
| EINECS |
202-621-4 |
| Molecular Structure |
|
| Density |
0.814g/cm3 |
| Melting point |
-15℃ |
| Boiling point |
146.5°C at 760 mmHg |
| Refractive index |
1.413 |
| Flash point |
58.3°C |
| Vapour Pressur |
1.81mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |