97-95-0 2-Ethyl-1-butanol
| Nom |
2-Ethyl-1-butanol |
| Nom anglais |
2-Ethyl-1-butanol; 2-Ethylbutyl alcohol; 2-ethylbutan-1-ol |
| Formule moléculaire |
C6H14O |
| Poids Moléculaire |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
| Numéro de registre CAS |
97-95-0 |
| EINECS |
202-621-4 |
| Structure moléculaire |
|
| Densité |
0.814g/cm3 |
| Point de fusion |
-15℃ |
| Point d'ébullition |
146.5°C at 760 mmHg |
| Indice de réfraction |
1.413 |
| Point d'éclair |
58.3°C |
| Pression de vapeur |
1.81mmHg at 25°C |
| Les symboles de danger |
Xn:Harmful;
|
| Codes des risques |
R21/22:Harmful in contact with skin and if swallowed.;
|
|