ChemNet > CAS > 3029-30-9 Naphthalene-1,4-dicarbonitrile
3029-30-9 Naphthalene-1,4-dicarbonitrile
| produktnavn |
Naphthalene-1,4-dicarbonitrile |
| Engelsk navn |
Naphthalene-1,4-dicarbonitrile; 1,4-Dicyanonaphthalene |
| Molekyl?r Formel |
C12H6N2 |
| Molekylvekt |
178.1894 |
| InChI |
InChI=1/C12H6N2/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12/h1-6H |
| CAS-nummer |
3029-30-9 |
| EINECS |
221-197-1 |
| Molecular Structure |
|
| Tetthet |
1.23g/cm3 |
| Kokepunkt |
401.2°C at 760 mmHg |
| Brytningsindeks |
1.663 |
| Flammepunktet |
205°C |
| Damptrykk |
1.21E-06mmHg at 25°C |
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|