ChemNet > CAS > 3029-30-9 Naphthalene-1,4-dicarbonitrile
3029-30-9 Naphthalene-1,4-dicarbonitrile
| Nome del prodotto |
Naphthalene-1,4-dicarbonitrile |
| Nome inglese |
Naphthalene-1,4-dicarbonitrile; 1,4-Dicyanonaphthalene |
| Formula molecolare |
C12H6N2 |
| Peso Molecolare |
178.1894 |
| InChI |
InChI=1/C12H6N2/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12/h1-6H |
| Numero CAS |
3029-30-9 |
| EINECS |
221-197-1 |
| Struttura molecolare |
|
| Densità |
1.23g/cm3 |
| Punto di ebollizione |
401.2°C at 760 mmHg |
| Indice di rifrazione |
1.663 |
| Punto d'infiammabilità |
205°C |
| Pressione di vapore |
1.21E-06mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|