ChemNet > CAS > 3029-30-9 Naphthalene-1,4-dicarbonitrile
3029-30-9 Naphthalene-1,4-dicarbonitrile
| product Name |
Naphthalene-1,4-dicarbonitrile |
| CAS No |
3029-30-9 |
| Synonyms |
1,4-Dicyanonaphthalene |
| Molecular Formula |
C12H6N2 |
| Molecular Weight |
178.1894 |
| InChI |
InChI=1/C12H6N2/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12/h1-6H |
| EINECS |
221-197-1 |
| Molecular Structure |
|
| Density |
1.23g/cm3 |
| Boiling point |
401.2°C at 760 mmHg |
| Refractive index |
1.663 |
| Flash point |
205°C |
| Vapour Pressur |
1.21E-06mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|