ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
| Naam product |
4-Iodophenylacetonitrile |
| Engelse naam |
4-Iodophenylacetonitrile; 4-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Molecuulgewicht |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| CAS-nummer |
51628-12-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.764g/cm3 |
| Kookpunt |
285.8°C at 760 mmHg |
| Brekingsindex |
1.624 |
| Vlampunt |
126.6°C |
| Dampdruk |
0.00275mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|