ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
| Ονομασ?α του προ??ντο? |
4-Iodophenylacetonitrile |
| Αγγλικ? ?νομα |
4-Iodophenylacetonitrile; 4-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Μοριακ? β?ρο? |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| CAS ΟΧΙ |
51628-12-7 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.764g/cm3 |
| Σημε?ο βρασμο? |
285.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.624 |
| Σημε?ο αν?φλεξη? |
126.6°C |
| Π?εση ατμ?ν |
0.00275mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|