ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
| Nome del prodotto |
4-Iodophenylacetonitrile |
| Nome inglese |
4-Iodophenylacetonitrile; 4-Iodobenzyl cyanide |
| Formula molecolare |
C8H6IN |
| Peso Molecolare |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| Numero CAS |
51628-12-7 |
| Struttura molecolare |
|
| Densità |
1.764g/cm3 |
| Punto di ebollizione |
285.8°C at 760 mmHg |
| Indice di rifrazione |
1.624 |
| Punto d'infiammabilità |
126.6°C |
| Pressione di vapore |
0.00275mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|