3085-76-5 Diisopropylcyanamide
| Naam product |
Diisopropylcyanamide |
| Engelse naam |
Diisopropylcyanamide;dipropan-2-ylcyanamide |
| MF |
C7H14N2 |
| Molecuulgewicht |
126.1995 |
| InChI |
InChI=1/C7H14N2/c1-6(2)9(5-8)7(3)4/h6-7H,1-4H3 |
| CAS-nummer |
3085-76-5 |
| EINECS |
221-401-9 |
| Moleculaire Structuur |
|
| Dichtheid |
0.867g/cm3 |
| Kookpunt |
193.3°C at 760 mmHg |
| Brekingsindex |
1.435 |
| Vlampunt |
78.9°C |
| Dampdruk |
0.468mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|