3085-76-5 Diisopropylcyanamide
| product Name |
Diisopropylcyanamide |
| CAS No |
3085-76-5 |
| Synonyms |
dipropan-2-ylcyanamide |
| Molecular Formula |
C7H14N2 |
| Molecular Weight |
126.1995 |
| InChI |
InChI=1/C7H14N2/c1-6(2)9(5-8)7(3)4/h6-7H,1-4H3 |
| EINECS |
221-401-9 |
| Molecular Structure |
|
| Density |
0.867g/cm3 |
| Boiling point |
193.3°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
78.9°C |
| Vapour Pressur |
0.468mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
|
| MSDS |
Material Safety Data Sheet
|
|