3085-76-5 Diisopropylcyanamide
| Produkt-Name |
Diisopropylcyanamide |
| Englischer Name |
Diisopropylcyanamide;dipropan-2-ylcyanamide |
| Molekulare Formel |
C7H14N2 |
| Molecular Weight |
126.1995 |
| InChI |
InChI=1/C7H14N2/c1-6(2)9(5-8)7(3)4/h6-7H,1-4H3 |
| CAS Registry Number |
3085-76-5 |
| EINECS |
221-401-9 |
| Molecular Structure |
|
| Dichte |
0.867g/cm3 |
| Siedepunkt |
193.3°C at 760 mmHg |
| Brechungsindex |
1.435 |
| Flammpunkt |
78.9°C |
| Dampfdruck |
0.468mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|