ChemNet > CAS > 874-87-3 p-(Methylthio)benzyl chloride
874-87-3 p-(Methylthio)benzyl chloride
| ürün Ad? |
p-(Methylthio)benzyl chloride |
| ingilizce ad? |
p-(Methylthio)benzyl chloride; 4-(Methylthio)benzyl chloride; 4-(Chloromethyl)thioanisole; 1-(chloromethyl)-4-(methylsulfanyl)benzene; 4-Chloromethyl thioanisole |
| Moleküler Formülü |
C8H9ClS |
| Molekül A??rl??? |
172.6751 |
| InChI |
InChI=1/C8H9ClS/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| CAS kay?t numaras? |
874-87-3 |
| EINECS |
212-870-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.16g/cm3 |
| Kaynama noktas? |
262.3°C at 760 mmHg |
| K?r?lma indisi |
1.574 |
| Alevlenme noktas? |
110.5°C |
| Buhar bas?nc? |
0.0179mmHg at 25°C |
| Risk Kodlar? |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|