ChemNet > CAS > 874-87-3 p-(Methylthio)benzyl chloride
874-87-3 p-(Methylthio)benzyl chloride
| product Name |
p-(Methylthio)benzyl chloride |
| CAS No |
874-87-3 |
| Synonyms |
4-(Methylthio)benzyl chloride; 4-(Chloromethyl)thioanisole; 1-(chloromethyl)-4-(methylsulfanyl)benzene; 4-Chloromethyl thioanisole |
| Molecular Formula |
C8H9ClS |
| Molecular Weight |
172.6751 |
| InChI |
InChI=1/C8H9ClS/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,6H2,1H3 |
| EINECS |
212-870-0 |
| Molecular Structure |
|
| Density |
1.16g/cm3 |
| Boiling point |
262.3°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
110.5°C |
| Vapour Pressur |
0.0179mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Telephone |
+86-571-88902507;88902517;88902509 |
| Email |
shoufu@shoufuchem.com |
| Address |
5/F, Yangfan Venture Plaza, 31 Xincheng Road, Binjiang District, Hangzhou City, Zhejiang Province, P.R.China |
| Telephone |
+86-576-88516108;88582618 |
| Email |
sales@xm-chem.com |
| Address |
89#, Binhai Road, Jiaojiang, Taizhou City, Zhejiang Province, China. |