830-03-5 4-Nitrophenyl acetate
| ürün Ad? |
4-Nitrophenyl acetate |
| ingilizce ad? |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
| Moleküler Formülü |
C8H7NO4 |
| Molekül A??rl??? |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| CAS kay?t numaras? |
830-03-5 |
| EINECS |
212-593-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.304g/cm3 |
| Ergime noktas? |
76-79℃ |
| Kaynama noktas? |
296.8°C at 760 mmHg |
| K?r?lma indisi |
1.548 |
| Alevlenme noktas? |
145.2°C |
| Buhar bas?nc? |
0.0014mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|