830-03-5 4-Nitrophenyl acetate
| Naam product |
4-Nitrophenyl acetate |
| Engelse naam |
4-Nitrophenyl acetate; Acetic acid 4-nitrophenyl ester; p-Nitrophenol acetate |
| MF |
C8H7NO4 |
| Molecuulgewicht |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| CAS-nummer |
830-03-5 |
| EINECS |
212-593-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.304g/cm3 |
| Smeltpunt |
76-79℃ |
| Kookpunt |
296.8°C at 760 mmHg |
| Brekingsindex |
1.548 |
| Vlampunt |
145.2°C |
| Dampdruk |
0.0014mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|