ChemNet > CAS > 6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
| ürün Ad? |
3-chloro-4-methyl-7-hydroxycoumarin |
| ingilizce ad? |
3-chloro-4-methyl-7-hydroxycoumarin; 3-Chloro-4-methylumbelliferone; 3-Chloro-7-hydroxy-4-methylcoumarin; 3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one |
| Moleküler Formülü |
C10H7ClO3 |
| Molekül A??rl??? |
210.6138 |
| InChI |
InChI=1/C10H7ClO3/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-4,12H,1H3 |
| CAS kay?t numaras? |
6174-86-3 |
| EINECS |
228-217-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.48g/cm3 |
| Kaynama noktas? |
405.8°C at 760 mmHg |
| K?r?lma indisi |
1.637 |
| Alevlenme noktas? |
199.2°C |
| Buhar bas?nc? |
3.63E-07mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|