ChemNet > CAS > 6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
6174-86-3 3-chloro-4-methyl-7-hydroxycoumarin
| Ονομασ?α του προ??ντο? |
3-chloro-4-methyl-7-hydroxycoumarin |
| Αγγλικ? ?νομα |
3-chloro-4-methyl-7-hydroxycoumarin; 3-Chloro-4-methylumbelliferone; 3-Chloro-7-hydroxy-4-methylcoumarin; 3-chloro-7-hydroxy-4-methyl-2H-chromen-2-one |
| MF |
C10H7ClO3 |
| Μοριακ? β?ρο? |
210.6138 |
| InChI |
InChI=1/C10H7ClO3/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-4,12H,1H3 |
| CAS ΟΧΙ |
6174-86-3 |
| EINECS |
228-217-8 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.48g/cm3 |
| Σημε?ο βρασμο? |
405.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.637 |
| Σημε?ο αν?φλεξη? |
199.2°C |
| Π?εση ατμ?ν |
3.63E-07mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|