6047-91-2 2-Furylglyoxylonitrile
| ürün Ad? |
2-Furylglyoxylonitrile |
| ingilizce ad? |
2-Furylglyoxylonitrile; 2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
| Moleküler Formülü |
C6H3NO2 |
| Molekül A??rl??? |
121.0935 |
| InChI |
InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
| CAS kay?t numaras? |
6047-91-2 |
| EINECS |
227-944-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.246g/cm3 |
| Ergime noktas? |
19-87℃ |
| Kaynama noktas? |
175.8°C at 760 mmHg |
| K?r?lma indisi |
1.498 |
| Alevlenme noktas? |
60.1°C |
| Buhar bas?nc? |
1.13mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|