6047-91-2 2-Furylglyoxylonitrile
| Nama produk |
2-Furylglyoxylonitrile |
| Nama Inggeris |
2-Furylglyoxylonitrile; 2-Furoyl cyanide; Furylglyoxylonitrile; alpha-Oxo-2-furanacetonitrile; furan-2-yl(oxo)acetonitrile |
| MF |
C6H3NO2 |
| Berat Molekul |
121.0935 |
| InChI |
InChI=1/C6H3NO2/c7-4-5(8)6-2-1-3-9-6/h1-3H |
| CAS NO |
6047-91-2 |
| EINECS |
227-944-8 |
| Struktur Molekul |
|
| Kepadatan |
1.246g/cm3 |
| Titik lebur |
19-87℃ |
| Titik didih |
175.8°C at 760 mmHg |
| Indeks bias |
1.498 |
| Titik nyala |
60.1°C |
| Tekanan wap |
1.13mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|