ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
| ürün Ad? |
3-Ethoxy-2-cyclohexen-1-one |
| ingilizce ad? |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
| Moleküler Formülü |
C8H12O2 |
| Molekül A??rl??? |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
| CAS kay?t numaras? |
5323-87-5 |
| EINECS |
226-190-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1g/cm3 |
| Kaynama noktas? |
250.1°C at 760 mmHg |
| K?r?lma indisi |
1.467 |
| Alevlenme noktas? |
107.2°C |
| Buhar bas?nc? |
0.022mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|