ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
| Nama produk |
3-Ethoxy-2-cyclohexen-1-one |
| Nama bahasa Inggris |
3-Ethoxy-2-cyclohexen-1-one; 3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
| MF |
C8H12O2 |
| Berat Molekul |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
| CAS NO |
5323-87-5 |
| EINECS |
226-190-7 |
| Struktur Molekul |
|
| Kepadatan |
1g/cm3 |
| Titik didih |
250.1°C at 760 mmHg |
| Indeks bias |
1.467 |
| Titik nyala |
107.2°C |
| Tekanan uap |
0.022mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|