502-50-1 4-Ketopimelic acid
| ürün Ad? |
4-Ketopimelic acid |
| ingilizce ad? |
4-Ketopimelic acid; 4-Oxopimelic acid; 4-oxoheptanedioic acid; 4-oxoheptanedioate |
| Moleküler Formülü |
C7H8O5 |
| Molekül A??rl??? |
172.1365 |
| InChI |
InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| CAS kay?t numaras? |
502-50-1 |
| EINECS |
207-941-8 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
142-144℃ |
| Kaynama noktas? |
420.4°C at 760 mmHg |
| Alevlenme noktas? |
222.2°C |
| Buhar bas?nc? |
3.03E-08mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|