502-50-1 4-Ketopimelic acid
| product Name |
4-Ketopimelic acid |
| CAS No |
502-50-1 |
| Synonyms |
4-Oxopimelic acid; 4-oxoheptanedioic acid; 4-oxoheptanedioate |
| Molecular Formula |
C7H8O5 |
| Molecular Weight |
172.1365 |
| InChI |
InChI=1/C7H10O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2,(H,9,10)(H,11,12)/p-2 |
| EINECS |
207-941-8 |
| Molecular Structure |
|
| Melting point |
142-144℃ |
| Boiling point |
420.4°C at 760 mmHg |
| Flash point |
222.2°C |
| Vapour Pressur |
3.03E-08mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|