50-66-8 6-(Methylthio)purine
| ürün Ad? |
6-(Methylthio)purine |
| ingilizce ad? |
6-(Methylthio)purine; 6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
| Moleküler Formülü |
C6H6N4S |
| Molekül A??rl??? |
166.2036 |
| InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
| CAS kay?t numaras? |
50-66-8 |
| EINECS |
200-057-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.59g/cm3 |
| Ergime noktas? |
221-222℃ |
| Kaynama noktas? |
290.9°C at 760 mmHg |
| K?r?lma indisi |
1.806 |
| Alevlenme noktas? |
129.7°C |
| Buhar bas?nc? |
0.00351mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|