50-66-8 6-(Methylthio)purine
| Nome del prodotto |
6-(Methylthio)purine |
| Nome inglese |
6-(Methylthio)purine; 6-(Methylmercapto)purine; 6-(Methylsulfanyl)-9H-purine; 6-(methylsulfanyl)-7H-purine; 6-(methylsulfanyl)-5H-purine |
| Formula molecolare |
C6H6N4S |
| Peso Molecolare |
166.2036 |
| InChI |
InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
| Numero CAS |
50-66-8 |
| EINECS |
200-057-3 |
| Struttura molecolare |
|
| Densità |
1.59g/cm3 |
| Punto di fusione |
221-222℃ |
| Punto di ebollizione |
290.9°C at 760 mmHg |
| Indice di rifrazione |
1.806 |
| Punto d'infiammabilità |
129.7°C |
| Pressione di vapore |
0.00351mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|