486-70-4 lupinine
| ürün Ad? |
lupinine |
| ingilizce ad? |
lupinine; (-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
| Moleküler Formülü |
C10H19NO |
| Molekül A??rl??? |
169.264 |
| InChI |
InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| CAS kay?t numaras? |
486-70-4 |
| EINECS |
207-638-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.04g/cm3 |
| Ergime noktas? |
68-69℃ |
| Kaynama noktas? |
270°C at 760 mmHg |
| K?r?lma indisi |
1.525 |
| Alevlenme noktas? |
99.1°C |
| Buhar bas?nc? |
0.000928mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|