486-70-4 lupinine
| Produkt-Name |
lupinine |
| Englischer Name |
lupinine; (-)-Lupinine; (1R-trans)-Octahydro-2H-quinolizine-1-methanol; (1R,9aR)-octahydro-2H-quinolizin-1-ylmethanol; (1S,9aR)-octahydro-2H-quinolizin-1-ylmethanol |
| Molekulare Formel |
C10H19NO |
| Molecular Weight |
169.264 |
| InChI |
InChI=1/C10H19NO/c12-8-9-4-3-7-11-6-2-1-5-10(9)11/h9-10,12H,1-8H2/t9-,10-/m1/s1 |
| CAS Registry Number |
486-70-4 |
| EINECS |
207-638-0 |
| Molecular Structure |
|
| Dichte |
1.04g/cm3 |
| Schmelzpunkt |
68-69℃ |
| Siedepunkt |
270°C at 760 mmHg |
| Brechungsindex |
1.525 |
| Flammpunkt |
99.1°C |
| Dampfdruck |
0.000928mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|