2114-39-8 2-Bromo-1-phenylpropane
| ürün Ad? |
2-Bromo-1-phenylpropane |
| ingilizce ad? |
2-Bromo-1-phenylpropane; (2-Bromopropyl)benzene |
| Moleküler Formülü |
C9H11Br |
| Molekül A??rl??? |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| CAS kay?t numaras? |
2114-39-8 |
| EINECS |
218-315-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.307g/cm3 |
| Kaynama noktas? |
228°C at 760 mmHg |
| K?r?lma indisi |
1.544 |
| Alevlenme noktas? |
90.6°C |
| Buhar bas?nc? |
0.113mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|