2114-39-8 2-Bromo-1-phenylpropane
| Nama produk |
2-Bromo-1-phenylpropane |
| Nama bahasa Inggris |
2-Bromo-1-phenylpropane; (2-Bromopropyl)benzene |
| MF |
C9H11Br |
| Berat Molekul |
199.0876 |
| InChI |
InChI=1/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| CAS NO |
2114-39-8 |
| EINECS |
218-315-9 |
| Struktur Molekul |
|
| Kepadatan |
1.307g/cm3 |
| Titik didih |
228°C at 760 mmHg |
| Indeks bias |
1.544 |
| Titik nyala |
90.6°C |
| Tekanan uap |
0.113mmHg at 25°C |
| Simbol bahaya |
Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|