ChemNet > CAS > 1674-30-2 2-chloro-1-phenylethanol
1674-30-2 2-chloro-1-phenylethanol
| ürün Ad? |
2-chloro-1-phenylethanol |
| ingilizce ad? |
2-chloro-1-phenylethanol; styrene chlorohydrin; [2-(chloromethyl)phenyl]methanol |
| Moleküler Formülü |
C8H9ClO |
| Molekül A??rl??? |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
| CAS kay?t numaras? |
1674-30-2 |
| EINECS |
216-816-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.196g/cm3 |
| Kaynama noktas? |
267.289°C at 760 mmHg |
| K?r?lma indisi |
1.562 |
| Alevlenme noktas? |
119.526°C |
| Buhar bas?nc? |
0.004mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|