ChemNet > CAS > 1674-30-2 2-chloro-1-phenylethanol
1674-30-2 2-chloro-1-phenylethanol
| Nome del prodotto |
2-chloro-1-phenylethanol |
| Nome inglese |
2-chloro-1-phenylethanol; styrene chlorohydrin; [2-(chloromethyl)phenyl]methanol |
| Formula molecolare |
C8H9ClO |
| Peso Molecolare |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
| Numero CAS |
1674-30-2 |
| EINECS |
216-816-7 |
| Struttura molecolare |
|
| Densità |
1.196g/cm3 |
| Punto di ebollizione |
267.289°C at 760 mmHg |
| Indice di rifrazione |
1.562 |
| Punto d'infiammabilità |
119.526°C |
| Pressione di vapore |
0.004mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|