ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
| ürün Ad? |
Cyclohexanone 2,4-dinitrophenylhydrazone |
| ingilizce ad? |
Cyclohexanone 2,4-dinitrophenylhydrazone;Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
| Moleküler Formülü |
C12H14N4O4 |
| Molekül A??rl??? |
278.264 |
| InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
| CAS kay?t numaras? |
1589-62-4 |
| EINECS |
216-458-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.47g/cm3 |
| Ergime noktas? |
159-161℃ |
| Kaynama noktas? |
434.6°C at 760 mmHg |
| K?r?lma indisi |
1.665 |
| Alevlenme noktas? |
216.7°C |
| Buhar bas?nc? |
9.33E-08mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|