ChemNet > CAS > 1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
1589-62-4 Cyclohexanone 2,4-dinitrophenylhydrazone
| product Name |
Cyclohexanone 2,4-dinitrophenylhydrazone |
| CAS No |
1589-62-4 |
| Synonyms |
Cyclohexanone-2,4-dinitrophenylhydrazone; AI3-16296; Cyclohexanone, (2,4-dinitrophenyl)hydrazone; 1-cyclohexylidene-2-(2,4-dinitrophenyl)hydrazine |
| Molecular Formula |
C12H14N4O4 |
| Molecular Weight |
278.264 |
| InChI |
InChI=1/C12H14N4O4/c17-15(18)10-6-7-11(12(8-10)16(19)20)14-13-9-4-2-1-3-5-9/h6-8,14H,1-5H2 |
| EINECS |
216-458-1 |
| Molecular Structure |
|
| Density |
1.47g/cm3 |
| Melting point |
159-161℃ |
| Boiling point |
434.6°C at 760 mmHg |
| Refractive index |
1.665 |
| Flash point |
216.7°C |
| Vapour Pressur |
9.33E-08mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|