ChemNet > CAS > 14109-72-9 1-Methylthio-2-propanone
14109-72-9 1-Methylthio-2-propanone
| ürün Ad? |
1-Methylthio-2-propanone |
| ingilizce ad? |
1-Methylthio-2-propanone; 1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
| Moleküler Formülü |
C4H8OS |
| Molekül A??rl??? |
104.1707 |
| InChI |
InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
| CAS kay?t numaras? |
14109-72-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.985g/cm3 |
| Kaynama noktas? |
144°C at 760 mmHg |
| K?r?lma indisi |
1.453 |
| Alevlenme noktas? |
42.8°C |
| Buhar bas?nc? |
5.19mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|