ChemNet > CAS > 14109-72-9 1-Methylthio-2-propanone
14109-72-9 1-Methylthio-2-propanone
| produktnavn |
1-Methylthio-2-propanone |
| Engelsk navn |
1-Methylthio-2-propanone; 1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
| Molekyl?r Formel |
C4H8OS |
| Molekylvekt |
104.1707 |
| InChI |
InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
| CAS-nummer |
14109-72-9 |
| Molecular Structure |
|
| Tetthet |
0.985g/cm3 |
| Kokepunkt |
144°C at 760 mmHg |
| Brytningsindeks |
1.453 |
| Flammepunktet |
42.8°C |
| Damptrykk |
5.19mmHg at 25°C |
| Risiko Koder |
R10:Flammable.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|