133-49-3 Penta-Chloro Thiophenol
| ürün Ad? |
Penta-Chloro Thiophenol |
| ingilizce ad? |
Penta-Chloro Thiophenol; Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
| Moleküler Formülü |
C6HCl5S |
| Molekül A??rl??? |
282.4021 |
| InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| CAS kay?t numaras? |
133-49-3 |
| EINECS |
205-107-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.745g/cm3 |
| Ergime noktas? |
223-227℃ |
| Kaynama noktas? |
351.3°C at 760 mmHg |
| K?r?lma indisi |
1.648 |
| Alevlenme noktas? |
144.6°C |
| Buhar bas?nc? |
8.41E-05mmHg at 25°C |
| Risk Kodlar? |
R20/22:Harmful by inhalation and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|