133-49-3 Penta-Chloro Thiophenol
| Naam product |
Penta-Chloro Thiophenol |
| Engelse naam |
Penta-Chloro Thiophenol; Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
| MF |
C6HCl5S |
| Molecuulgewicht |
282.4021 |
| InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| CAS-nummer |
133-49-3 |
| EINECS |
205-107-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.745g/cm3 |
| Smeltpunt |
223-227℃ |
| Kookpunt |
351.3°C at 760 mmHg |
| Brekingsindex |
1.648 |
| Vlampunt |
144.6°C |
| Dampdruk |
8.41E-05mmHg at 25°C |
| Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|