ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| ürün Ad? |
4-Chloro-3-fluorobenzonitrile |
| ingilizce ad? |
4-Chloro-3-fluorobenzonitrile; BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| Moleküler Formülü |
C7H3ClFN |
| Molekül A??rl??? |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| CAS kay?t numaras? |
110888-15-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.33g/cm3 |
| Ergime noktas? |
79-81°C |
| Kaynama noktas? |
214°C at 760 mmHg |
| K?r?lma indisi |
1.536 |
| Alevlenme noktas? |
83.2°C |
| Buhar bas?nc? |
0.159mmHg at 25°C |
| Tehlike Sembolleri |
T,Xi:;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|