ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| Naam product |
4-Chloro-3-fluorobenzonitrile |
| Engelse naam |
4-Chloro-3-fluorobenzonitrile; BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| MF |
C7H3ClFN |
| Molecuulgewicht |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| CAS-nummer |
110888-15-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.33g/cm3 |
| Smeltpunt |
79-81°C |
| Kookpunt |
214°C at 760 mmHg |
| Brekingsindex |
1.536 |
| Vlampunt |
83.2°C |
| Dampdruk |
0.159mmHg at 25°C |
| Gevaarsymbolen |
T,Xi:;
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|