771-51-7 3-Indolylacetonitrile
| Название продукта |
3-Indolylacetonitrile |
| Английское название |
3-Indolylacetonitrile; Indole-3-acetonitrile,(Indolyl-3-acetonitrile); Indolyl-3-acetonitrile; Indole-3-acetonitrile; 1H-Indole-3-acetonitrile; BETA-INDOLYLACETONITRILE; 2-(1H-INDOL-3-YL)ACETONITRILE; (1H-INDOL-3-YL)-ACETONITRILE; 3-INDOLEACETONITRILE; 3-Indole acetonitrile |
| Молекулярная формула |
C10H8N2 |
| Молекулярный вес |
156.18 |
| InChI |
InChI=1/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
| Регистрационный номер CAS |
771-51-7 |
| EINECS |
212-232-1 |
| Молекулярная структура |
|
| Плотность |
158 |
| Температура плавления |
33-35℃ |
| Точка кипения |
156-160℃(0.2 torr) |
| Показатель преломления |
1.6085-1.6105 |
| Температура вспышки |
206℃ |
| Символы опасности |
Xn:Harmful;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|